|
|
| | DIETHYL TERT-BUTYLMALONATE Basic information |
| Product Name: | DIETHYL TERT-BUTYLMALONATE | | Synonyms: | AURORA KA-6574;DIETHYL TERT-BUTYLMALONATE;Diethyl 2-tert-butylmalonate;Diethyl t-butylmalonate;Propanedioic acid, (1,1-dimethylethyl)-, diethyl ester;diethyl (1,1-dimethylethyl)malonate;1,1-dimethylethylpropandioc acid diethyl ester;(1,1-Dimethylethyl)propanedioic acid diethyl ester | | CAS: | 759-24-0 | | MF: | C11H20O4 | | MW: | 216.27 | | EINECS: | 212-067-5 | | Product Categories: | C10 to C11;Carbonyl Compounds;Esters | | Mol File: | 759-24-0.mol |  |
| | DIETHYL TERT-BUTYLMALONATE Chemical Properties |
| Boiling point | 102-104 °C/11 mmHg (lit.) | | density | 1.014 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.425(lit.) | | Fp | 195 °F | | form | liquid | | pka | 13.74±0.46(Predicted) | | Water Solubility | Immiscible with water. | | BRN | 1781709 | | InChI | 1S/C11H20O4/c1-6-14-9(12)8(11(3,4)5)10(13)15-7-2/h8H,6-7H2,1-5H3 | | InChIKey | RJNICNBRGVKNSR-UHFFFAOYSA-N | | SMILES | CCOC(=O)C(C(=O)OCC)C(C)(C)C |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | DIETHYL TERT-BUTYLMALONATE Usage And Synthesis |
| Uses | Diethyl tert-butylmalonate is used in the preparation of enantiomers of 4-tert-butyl-3-isopropyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane 1-sulfide. | | Purification Methods | Dissolve it in Et2O, wash with aqueous NaHCO3, H2O, dry (MgSO4), filter, evaporate and distil the residue. Identify by hydrolysis to the acid and determine the neutralisation equivalent (theor: 80.0). The acid has m 155-157o effervescence [Hauser et al. J Am Chem Soc 64 2715 1942, Bush & Beauchamp J Am Chem Soc 75 2949 1953]. [Beilstein 2 IV 2027.] |
| | DIETHYL TERT-BUTYLMALONATE Preparation Products And Raw materials |
|