| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:SulfaMerazine-13C6
Remarks:CS-O-00765
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Sulfamerazine-13C6
CAS:1196157-80-8
Purity:99% Package:10mg;100mg;1g
|
| Company Name: |
Hubei Yangxin Medical Technology Co., Ltd.
|
| Tel: |
15374522761 |
| Email: |
3003392093@yongstandards.com |
| Products Intro: |
Product Name:Sulfamerazine-13C6
CAS:1196157-80-8
Purity:99%+ HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
ShangHai Anpel Co, Ltd.
|
| Tel: |
18502138905 |
| Email: |
shanpel@anpel.com.cn |
| Products Intro: |
Product Name:Sulfamerazine-[13C6
CAS:1196157-80-8
Purity:100ppm Package:100mg/L于甲醇，1.2ml Remarks:CDAA-540085-10mg
|
|
| | SulfaMerazine-13C6 Basic information |
| Product Name: | SulfaMerazine-13C6 | | Synonyms: | SulfaMerazine-13C6;[13C6]-Sulfamerazine;Sulfamerazine-13C6 Solution, 100μg/mL;Sulfamerazine 13C6Q: What is
Sulfamerazine 13C6 Q: What is the CAS Number of
Sulfamerazine 13C6 Q: What is the storage condition of
Sulfamerazine 13C6 Q: What are the applications of
Sulfamerazine 13C6;Sulfamerazine-(phenyl-13C6);Sulfamerazine 13C6 (phenyl 13C6) | | CAS: | 1196157-80-8 | | MF: | C11H12N4O2S | | MW: | 270.35758 | | EINECS: | | | Product Categories: | | | Mol File: | 1196157-80-8.mol |  |
| | SulfaMerazine-13C6 Chemical Properties |
| Major Application | clinical testing | | InChI | 1S/C11H12N4O2S/c1-8-6-7-13-11(14-8)15-18(16,17)10-4-2-9(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15)/i2+1,3+1,4+1,5+1,9+1,10+1 | | InChIKey | QPPBRPIAZZHUNT-PBZDKDNVSA-N | | SMILES | Cc1ccnc(NS(=O)(=O)[13c]2[13cH][13cH][13c](N)[13cH][13cH]2)n1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | SulfaMerazine-13C6 Usage And Synthesis |
| Uses | Sulfamerazine-13C6 is the isotopic labeled analogue of antibacterial drug Sulfamerazine. Antibacterial. |
| | SulfaMerazine-13C6 Preparation Products And Raw materials |
|