| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | IMp. C (EP): 1,1'-Oxybis[3-(2-Methoxyphenoxy)propan-2-ol] (Bisether) Basic information |
| | IMp. C (EP): 1,1'-Oxybis[3-(2-Methoxyphenoxy)propan-2-ol] (Bisether) Chemical Properties |
| form | liquid | | Major Application | pharmaceutical small molecule | | InChI | 1S/C20H26O7/c1-23-17-7-3-5-9-19(17)26-13-15(21)11-25-12-16(22)14-27-20-10-6-4-8-18(20)24-2/h3-10,15-16,21-22H,11-14H2,1-2H3 | | InChIKey | AFKSAYSHFVIMCI-UHFFFAOYSA-N | | SMILES | OC(COCC(COC1=C(OC)C=CC=C1)O)COC2=CC=CC=C2OC |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | IMp. C (EP): 1,1'-Oxybis[3-(2-Methoxyphenoxy)propan-2-ol] (Bisether) Usage And Synthesis |
| Uses | These Secondary Standards are qualified as Certified Reference Materials. These are suitable for use in several analytical applications including but not limited to pharma release testing, pharma method development for qualitative and quantitative analyses, food and beverage quality control testing, and other calibration requirements. |
| | IMp. C (EP): 1,1'-Oxybis[3-(2-Methoxyphenoxy)propan-2-ol] (Bisether) Preparation Products And Raw materials |
|