|
|
| | 4-Methoxybenzyl azide Basic information |
| Product Name: | 4-Methoxybenzyl azide | | Synonyms: | Benzene, 1-(azidomethyl)-4-methoxy-;4-(Azidomethyl)anisole;1-(Azidomethyl)-4-methoxybenzene - [A9117];1-(azamethyl)-4-methoxybenzene | | CAS: | 70978-37-9 | | MF: | C8H9N3O | | MW: | 163.17656 | | EINECS: | | | Product Categories: | | | Mol File: | 70978-37-9.mol |  |
| | 4-Methoxybenzyl azide Chemical Properties |
| Melting point | 70-71℃ | | Boiling point | 126 °C(Press: 14 Torr) | | density | 1.063 g/cm3 (420 ºC) | | refractive index | 1.5272 (589.3 nm 20℃) | | InChI | InChI=1S/C8H9N3O/c1-12-8-4-2-7(3-5-8)6-10-11-9/h2-5H,6H2,1H3 | | InChIKey | IAKGGJYLHBHSQD-UHFFFAOYSA-N | | SMILES | C(N=[N+]=[N-])C1=CC=C(OC)C=C1 |
| | 4-Methoxybenzyl azide Usage And Synthesis |
| | 4-Methoxybenzyl azide Preparation Products And Raw materials |
|