|
|
| | 1-Methyl-1H-pyrazole-5-carbonitrile Basic information |
| | 1-Methyl-1H-pyrazole-5-carbonitrile Chemical Properties |
| Melting point | 23-26 °C(Solv: hexane (110-54-3)) | | Boiling point | 90 °C(Press: 8 Torr) | | density | 1.12±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | -0.53±0.10(Predicted) | | Appearance | Colorless to off-white <23°C Solid,>26°C Liquid | | InChI | InChI=1S/C5H5N3/c1-8-5(4-6)2-3-7-8/h2-3H,1H3 | | InChIKey | WMZMVWZFGUVSTA-UHFFFAOYSA-N | | SMILES | N1(C)C(C#N)=CC=N1 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | HS Code | 2933199090 |
| | 1-Methyl-1H-pyrazole-5-carbonitrile Usage And Synthesis |
| | 1-Methyl-1H-pyrazole-5-carbonitrile Preparation Products And Raw materials |
|