| Company Name: |
Beijing Green Guardee Technology Co., Ltd |
| Tel: |
86-010-69706062 |
| Email: |
sales2@greenguardee.com |
| Products Intro: |
Product Name:2-(4-PYRIDYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE; 4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE; 4-PYRIDYLBORONIC ACID PINACOL ESTER
CAS:181219-01-2
Purity:98% Package:1kg, 5kg, 20kg, at customer's requirement Remarks:oled materials
|
|
|
|
|
|
| | 4-Pyridineboronic acid pinacol ester Basic information |
| Product Name: | 4-Pyridineboronic acid pinacol ester | | Synonyms: | 2-(4-PYRIDYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE;AKOS BRN-0440;4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE;4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXOBOROLAN-2-YL)PYRIDINE;4-PYRIDINEBORONIC ACID, PINACOL ESTER;4-PYRIDYLBORONIC ACID PINACOL ESTER;4-Pyridineboronic acid, pinacol cyclic ester;4-Pyridineboronic acid pinacol ester 97% | | CAS: | 181219-01-2 | | MF: | C11H16BNO2 | | MW: | 205.06 | | EINECS: | 628-005-9 | | Product Categories: | blocks;BoronicAcids;Pyridines;Boronic ester;Organoborons;Pyridine;B (Classes of Boron Compounds);Boronic Acids Esters;Boronic acid;Boronate Esters;Boronic Acids and Derivatives;Chemical Synthesis;Heteroaryl Boronate Esters;Organometallic Reagents | | Mol File: | 181219-01-2.mol |  |
| | 4-Pyridineboronic acid pinacol ester Chemical Properties |
| Melting point | 149-153 °C (lit.) | | Boiling point | 300.9±15.0 °C(Predicted) | | density | 1.03±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Powder | | pka | 4.32±0.10(Predicted) | | color | White to off-white | | Water Solubility | Insoluble | | BRN | 7919059 | | InChI | 1S/C11H16BNO2/c1-10(2)11(3,4)15-12(14-10)9-5-7-13-8-6-9/h5-8H,1-4H3 | | InChIKey | NLTIETZTDSJANS-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)c2ccncc2 | | CAS DataBase Reference | 181219-01-2(CAS DataBase Reference) |
| Hazard Codes | Xi,C,F | | Risk Statements | 36/37/38-34-11 | | Safety Statements | 26-36-45-36/37/39-16 | | WGK Germany | 3 | | TSCA | No | | HazardClass | IRRITANT | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Pyridineboronic acid pinacol ester Usage And Synthesis |
| Chemical Properties | white to off-white powder | | Uses | 4-Pyridineboronic Acid Pinacol ester is used in dermatological preparations containing antioxidants and boron compounds for preventing damages to skin caused by peroxides. | | Uses | It is employed in the synthesis of new pyridazino[4,5-b]indol-4-ones and pyridazin-3(2H)-one analogs as DYRK1A inhibitors. |
| | 4-Pyridineboronic acid pinacol ester Preparation Products And Raw materials |
| Raw materials | 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-->Pyridine-->Bis(pinacolato)diboron | | Preparation Products | PYRIDINE, 4,4'-[1,1'-BIPHENYL]-4,4'-DIYLBIS--->1,4-Di(4-pyridyl)benzene-->tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine-1-carboxylate-->2,5-bis(pyrid-4-yl)pyridine-->2,5-Bis(4-pyridyl)furan, 97% |
|