|
|
| | 6-Chloro-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Basic information |
| Product Name: | 6-Chloro-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine | | Synonyms: | 6-Chloro-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine;Pyridine, 6-chloro-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- | | CAS: | 2096998-30-8 | | MF: | C12H17BClNO2 | | MW: | 253.53 | | EINECS: | | | Product Categories: | | | Mol File: | 2096998-30-8.mol |  |
| | 6-Chloro-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Chemical Properties |
| Boiling point | 360.3±42.0 °C(Predicted) | | density | 1.12±0.1 g/cm3(Predicted) | | pka | 0.19±0.10(Predicted) | | form | solid | | InChI | 1S/C12H17BClNO2/c1-8-6-7-9(14)15-10(8)13-16-11(2,3)12(4,5)17-13/h6-7H,1-5H3 | | InChIKey | KGCCRLWSFGILDW-UHFFFAOYSA-N | | SMILES | Cc1ccc(Cl)nc1B2OC(C)(C)C(C)(C)O2 |
| Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Dam. 1 |
| | 6-Chloro-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Usage And Synthesis |
| | 6-Chloro-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Preparation Products And Raw materials |
|