|
|
| | 4-CYANO-2-FLUOROBENZOIC ACID Basic information |
| | 4-CYANO-2-FLUOROBENZOIC ACID Chemical Properties |
| Melting point | 214-216°C | | Boiling point | 326.3±27.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Powder or Crystalline Powder | | pka | 2.61±0.10(Predicted) | | color | White to pale brown | | Water Solubility | Insoluble in water. | | BRN | 8051929 | | InChI | InChI=1S/C8H4FNO2/c9-7-3-5(4-10)1-2-6(7)8(11)12/h1-3H,(H,11,12) | | InChIKey | KEJMSTJTAWACNI-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(C#N)C=C1F | | CAS DataBase Reference | 164149-28-4(CAS DataBase Reference) |
| Hazard Codes | Xi,T,Xn | | Risk Statements | 22-36/37/38-41 | | Safety Statements | 26-36/37/39-39 | | RIDADR | 3439 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| Provider | Language |
|
ALFA
| English |
| | 4-CYANO-2-FLUOROBENZOIC ACID Usage And Synthesis |
| Chemical Properties | Off-white powder | | Uses | 4-Cyano-2-fluorobenzoic acid is an important raw material and intermediate used in organic synthesis, pharmaceuticals agrochemicals and dyestuff fields. |
| | 4-CYANO-2-FLUOROBENZOIC ACID Preparation Products And Raw materials |
|