| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | [1-(4-Chlorophenyl)cyclohexyl]methanol Basic information |
| | [1-(4-Chlorophenyl)cyclohexyl]methanol Chemical Properties |
| Boiling point | 331.5±25.0 °C(Predicted) | | density | 1.125±0.06 g/cm3(Predicted) | | pka | 15.05±0.10(Predicted) | | form | solid | | InChI | 1S/C13H17ClO/c14-12-6-4-11(5-7-12)13(10-15)8-2-1-3-9-13/h4-7,15H,1-3,8-10H2 | | InChIKey | TWVFAFNSQPLUGZ-UHFFFAOYSA-N | | SMILES | ClC1=CC=C(C2(CO)CCCCC2)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Dermal Aquatic Acute 1 Aquatic Chronic 1 |
| | [1-(4-Chlorophenyl)cyclohexyl]methanol Usage And Synthesis |
| | [1-(4-Chlorophenyl)cyclohexyl]methanol Preparation Products And Raw materials |
|