| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
- AMPK activator
-
- $198.00
-
2026-07-27
- CAS:849727-81-7
- Purity:
- Supply Ability: 10g
|
| | 5-[3-[4-[2-(4-Fluorophenyl)ethoxy]phenyl]propyl]-2-furancarboxylic Acid Basic information |
| | 5-[3-[4-[2-(4-Fluorophenyl)ethoxy]phenyl]propyl]-2-furancarboxylic Acid Chemical Properties |
| storage temp. | Store at -20°C | | solubility | DMF: 25 mg/ml; DMF:PBS(pH 7.2)(1:1): 0.5 mg/ml; DMSO: 25 mg/ml; Ethanol: 2 mg/ml | | form | A crystalline solid | | color | light yellow | | InChI | 1S/C22H21FO4/c23-18-8-4-17(5-9-18)14-15-26-19-10-6-16(7-11-19)2-1-3-20-12-13-21(27-20)22(24)25/h4-13H,1-3,14-15H2,(H,24,25) | | InChIKey | MPLLLQUZNJSVTK-UHFFFAOYSA-N | | SMILES | Fc1ccc(cc1)CCOc2ccc(cc2)CCCc3[o]c(cc3)C(=O)O |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | 5-[3-[4-[2-(4-Fluorophenyl)ethoxy]phenyl]propyl]-2-furancarboxylic Acid Usage And Synthesis |
| Uses | 5-[3-[4-[2-(4-Fluorophenyl)ethoxy]phenyl]propyl]-2-furancarboxylic Acid, is an indirect activator of AMP-activated protein kinase, which is an enzyme that plays a role in cellular energy homeostasis. | | Biological Activity | Cell permeable: yes', 'EC50 = 11.7 μM enhancing glucose uptake in L6 myocytes', 'Primary Target
AMPK', 'Product does not compete with ATP.', 'Reversible: no |
| | 5-[3-[4-[2-(4-Fluorophenyl)ethoxy]phenyl]propyl]-2-furancarboxylic Acid Preparation Products And Raw materials |
|