| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Hydroxyisovaleroyl-d3 Carnitine Basic information |
| | Hydroxyisovaleroyl-d3 Carnitine Chemical Properties |
| Melting point | >65oC (dec.) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]/D -16.0±2.0°, c =0.1 in H2O | | Stability: | Very Hygroscopic | | Major Application | clinical testing | | InChI | 1S/C12H23NO5/c1-12(2,17)7-11(16)18-9(6-10(14)15)8-13(3,4)5/h9,17H,6-8H2,1-5H3/t9-/m1/s1/i3D3 | | InChIKey | IGLHHSKNBDXCEY-MCHJGEEVSA-N | | SMILES | C[N+](C)(C([2H])([2H])[2H])C[C@H](OC(CC(C)(O)C)=O)CC([O-])=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Hydroxyisovaleroyl-d3 Carnitine Usage And Synthesis |
| Uses | Hydroxyisovaleroyl-d3 Carnitine is used as a diagnostic tool to identify the presence of orofacial clefts. Also used in the screening and diagnostics of inborn errors of metabolism. | | Uses | Isotope labelled (2R)-3-Hydroxyisovaleroyl Carnitine is used as a diagnostic tool to identify the presence of orofacial clefts. Also used in the screening and diagnostics of inborn errors of metabolism. |
| | Hydroxyisovaleroyl-d3 Carnitine Preparation Products And Raw materials |
|