|
|
| | 4-Chloro-2-nitrobenzonitrile Basic information |
| | 4-Chloro-2-nitrobenzonitrile Chemical Properties |
| Melting point | 99-101 | | Boiling point | 313.5±27.0 °C(Predicted) | | density | 1.47±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | form | powder | | color | lemon | | InChI | 1S/C7H3ClN2O2/c8-6-2-1-5(4-9)7(3-6)10(11)12/h1-3H | | InChIKey | OZKOAADVLVCNFO-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cc(Cl)ccc1C#N | | CAS DataBase Reference | 34662-32-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-24/25 | | WGK Germany | 3 | | Hazard Note | Harmful/Irritant | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Chloro-2-nitrobenzonitrile Usage And Synthesis |
| Description | 4-Chloro-2-nitrobenzonitrile [34662-32-3], 1-chloro-4-cyano-3-nitrobenzene, Mr 182.57, mp 100 – 101℃, is obtained by the Sandmeyer reaction of 4-chloro-2-nitrobenzene diazonium salt with copper cyanide. Reduction of the nitro group with iron yields 2-amino-4-chlorobenzonitrile: the latter is an intermediate for the production of azo dyes. |
| | 4-Chloro-2-nitrobenzonitrile Preparation Products And Raw materials |
|