4-BroMo-3,5-difluorobenzoic acid manufacturers
|
| | 4-BroMo-3,5-difluorobenzoic acid Basic information |
| | 4-BroMo-3,5-difluorobenzoic acid Chemical Properties |
| Melting point | 181-185℃ | | Boiling point | 284.4±40.0 °C(Predicted) | | density | 1.872±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 3.29±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C7H3BrF2O2/c8-6-4(9)1-3(7(11)12)2-5(6)10/h1-2H,(H,11,12) | | InChIKey | NLLRAEQVOZOSBB-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(F)=C(Br)C(F)=C1 |
| | 4-BroMo-3,5-difluorobenzoic acid Usage And Synthesis |
| Uses | It is used as a pharmaceutical intermediate. |
| | 4-BroMo-3,5-difluorobenzoic acid Preparation Products And Raw materials |
|