| Company Name: |
Pharmalego Gold |
| Tel: |
18321033991 |
| Email: |
marketing@pharmalego.com |
|
| | 2-Chloropyrrolo[2,1-f][1,2,4]triazine Basic information |
| Product Name: | 2-Chloropyrrolo[2,1-f][1,2,4]triazine | | Synonyms: | 2-Chloropyrrolo[2,1-f][1,2,4]triazine;Pyrrolo[2,1-f][1,2,4]triazine, 2-chloro- | | CAS: | 1363383-25-8 | | MF: | C6H4ClN3 | | MW: | 153.57 | | EINECS: | | | Product Categories: | | | Mol File: | 1363383-25-8.mol | ![2-Chloropyrrolo[2,1-f][1,2,4]triazine Structure](CAS/GIF/1363383-25-8.gif) |
| | 2-Chloropyrrolo[2,1-f][1,2,4]triazine Chemical Properties |
| density | 1.51±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, sealed storage, away from moisture | | pka | -4.06±0.30(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C6H4ClN3/c7-6-8-4-5-2-1-3-10(5)9-6/h1-4H | | InChIKey | XEBYYANMFBLKFL-UHFFFAOYSA-N | | SMILES | N12C=CC=C1C=NC(Cl)=N2 |
| | 2-Chloropyrrolo[2,1-f][1,2,4]triazine Usage And Synthesis |
| | 2-Chloropyrrolo[2,1-f][1,2,4]triazine Preparation Products And Raw materials |
|