| Company Name: |
Rhawn Reagent |
| Tel: |
400-400-1332688 18019345275 |
| Email: |
huyue@rhawn.cn |
|
| | 2-Methyl-2-propylbenzodithiolate Basic information |
| Product Name: | 2-Methyl-2-propylbenzodithiolate | | Synonyms: | Benzenecarbodithioic acid, 1,1-dimethylethyl ester;2-Methyl-2-propylbenzodithiolate;tert-Butyl benzodithioate;t-butyl dithiobenzoate;2-Methyl-2-propylbenzodithiol salt;2-Methyl-2-Propylbenzodithiolate
Benzenecarbodithioic acid, 1,1-dimethylethyl ester | | CAS: | 5925-55-3 | | MF: | C11H14S2 | | MW: | 210.36 | | EINECS: | | | Product Categories: | | | Mol File: | 5925-55-3.mol |  |
| | 2-Methyl-2-propylbenzodithiolate Chemical Properties |
| Boiling point | 105 °C(Press: 0.5 Torr) | | density | 1.093±0.06 g/cm3(Predicted) | | form | liquid | | color | red-orange | | Sensitive | light sensitive, store cold | | InChI | InChI=1S/C11H14S2/c1-11(2,3)13-10(12)9-7-5-4-6-8-9/h4-8H,1-3H3 | | InChIKey | NNADJWNJTLVMSL-UHFFFAOYSA-N | | SMILES | C1(C(=S)SC(C)(C)C)=CC=CC=C1 |
| | 2-Methyl-2-propylbenzodithiolate Usage And Synthesis |
| | 2-Methyl-2-propylbenzodithiolate Preparation Products And Raw materials |
|