| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Fluvastatin 3-Hydroxy-4,6-diene
CAS:1207963-21-0
Package:50Mg,5Mg
|
|
| | Fluvastatin 3-Hydroxy-4,6-diene Basic information |
| Product Name: | Fluvastatin 3-Hydroxy-4,6-diene | | Synonyms: | Fluvastatin Impurity F;Fluvastatin EP IMP F;Fluvastatin EP Impurity F Sodium Salt;WARCEOCHTLFKTQ-GZTQOXHUSA-N;Fluvastatin EP impurity F;Fluvastatin Impurity 6 (Fluvastatin EP Impurity F);4,6-Heptadienoic acid, 7-[3-(4-fluorophenyl)-1-(1-methylethyl)-1H-indol-2-yl]-3-hydroxy-;(4E,6E)-7-(3-(4-fluorophenyl)-1-isopropyl-1H-indol-2-yl)-3-hydroxyhepta-4,6-dienoic acid? (Fluvastatin Impurity） | | CAS: | 1207963-21-0 | | MF: | C24H24FNO3 | | MW: | 393.45 | | EINECS: | | | Product Categories: | | | Mol File: | 1207963-21-0.mol |  |
| | Fluvastatin 3-Hydroxy-4,6-diene Chemical Properties |
| Boiling point | 630.8±55.0 °C(Predicted) | | density | 1.16±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO (Slightly) | | form | Solid | | pka | 4.22±0.10(Predicted) | | color | Yellow | | Stability: | Hygroscopic, Light Sensitive, Temperature Sensitive | | Major Application | pharmaceutical
pharmaceutical small molecule | | InChI | InChI=1S/C24H24FNO3/c1-16(2)26-21-9-6-4-8-20(21)24(17-11-13-18(25)14-12-17)22(26)10-5-3-7-19(27)15-23(28)29/h3-14,16,19,27H,15H2,1-2H3,(H,28,29) | | InChIKey | WARCEOCHTLFKTQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)CC(O)C=CC=CC1=C(C2=CC=C(F)C=C2)C2=C(N1C(C)C)C=CC=C2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Fluvastatin 3-Hydroxy-4,6-diene Usage And Synthesis |
| Uses | Fluvastatin 3-Hydroxy-4,6-diene Sodium Salt is a metabolite of Fluvastatin (F601250), a synthetic HMG-CoA reductase inhibitor. Antilipemic. |
| | Fluvastatin 3-Hydroxy-4,6-diene Preparation Products And Raw materials |
|