|
|
| | cis-1-N-Boc-3-methyl-isonipecoticacid Basic information |
| Product Name: | cis-1-N-Boc-3-methyl-isonipecoticacid | | Synonyms: | cis-1-[(tert-Butoxy)carbonyl]-3-methylpiperidine-4-carboxylic acid;1,4-PIPERIDINEDICARBOXYLIC ACID, 3-METHYL-, 1-(1,1-DIMETHYLETHYL) ESTER, (3R,4R)-REL-;cis-1-Boc-3-methylpiperidine-4-carboxylic Acid;rel-(3R,4R)-1-(tert-Butoxycarbonyl)-3-methylpiperidine-4-carboxylic acid;cis-1-tert-butoxycarbonyl-3-methyl-piperidine-4-carboxylic acid - [B17473];(3R,4R)-rel-1-(tert-Butoxycarbonyl)-3-methylpiperidine-4-carboxylic acid;rel-1-(1,1-Dimethylethyl) (3R,4R)-3-methyl-1,4-piperidinedicarboxylate;cis-1-N-Boc-3-methyl-isonipecoticacid | | CAS: | 1207267-93-3 | | MF: | C12H21NO4 | | MW: | 243.3 | | EINECS: | | | Product Categories: | | | Mol File: | 1207267-93-3.mol |  |
| | cis-1-N-Boc-3-methyl-isonipecoticacid Chemical Properties |
| Boiling point | 359.512±35.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.122±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Store at room temperature | | pka | 4.573±0.40(predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1/C12H21NO4/c1-8-7-13(6-5-9(8)10(14)15)11(16)17-12(2,3)4/h8-9H,5-7H2,1-4H3,(H,14,15)/t8-,9+/s3 | | InChIKey | ZFQQTPBWJCJGSV-MASDURLHNA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC[C@@H](C(O)=O)[C@@H](C)C1 |&1:10,14,r| |
| | cis-1-N-Boc-3-methyl-isonipecoticacid Usage And Synthesis |
| | cis-1-N-Boc-3-methyl-isonipecoticacid Preparation Products And Raw materials |
|