FMoc-α-Me-Phe(2,6-DiF)-OH manufacturers
|
| | FMoc-α-Me-Phe(2,6-DiF)-OH Basic information |
| Product Name: | FMoc-α-Me-Phe(2,6-DiF)-OH | | Synonyms: | (S)- N-FMOC-Α-METHYL-2,6-DIFLUOROPHENYLALANINE;FMoc-α-Me-Phe(2,6-DiF)-OH;(9H-Fluoren-9-yl)MethOxy]Carbonyl Alpha-Methyl-Phe(2,6-DiF)-OH;Fmoc-alfa-Me-Phe(2,6-diF)-OH;Fmoc-alpha-Me-L-Phe(2,6-F2)-OH;(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2,6-difluorophenyl)-2-methylpropanoic acid;Fmoc-alpha-methyl-L-2,6-difluorophe;N-Fmoc-(S)-2,6-difluoro-α-methylphenylalanine | | CAS: | 1223105-51-8 | | MF: | C25H21F2NO4 | | MW: | 437.4353464 | | EINECS: | | | Product Categories: | α-Methyl Amino Acids | | Mol File: | 1223105-51-8.mol |  |
| | FMoc-α-Me-Phe(2,6-DiF)-OH Chemical Properties |
| Boiling point | 616.5±55.0 °C(Predicted) | | density | 1.333±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.80±0.21(Predicted) | | form | powder | | color | white | | InChIKey | MRIVYBRWULFPFJ-VWLOTQADSA-N | | SMILES | Fc1c(c(ccc1)F)C[C@@](NC(=O)OCC2c3c(cccc3)c4c2cccc4)(C)C(=O)O |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | TSCA | No | | Storage Class | 11 - Combustible Solids |
| | FMoc-α-Me-Phe(2,6-DiF)-OH Usage And Synthesis |
| | FMoc-α-Me-Phe(2,6-DiF)-OH Preparation Products And Raw materials |
|