| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | 2-(3-Fluoro-phenyl)-cyclopropanecarboxylic acid Basic information |
| | 2-(3-Fluoro-phenyl)-cyclopropanecarboxylic acid Chemical Properties |
| Boiling point | 309.9±42.0 °C(Predicted) | | density | 1.345±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 4.54±0.10(Predicted) | | Appearance | white solid | | InChI | 1S/C10H9FO2/c11-7-3-1-2-6(4-7)8-5-9(8)10(12)13/h1-4,8-9H,5H2,(H,12,13) | | InChIKey | WRSJNCVKPWFCPM-UHFFFAOYSA-N | | SMILES | OC(C1CC1C2=CC=CC(F)=C2)=O |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-(3-Fluoro-phenyl)-cyclopropanecarboxylic acid Usage And Synthesis |
| Uses | 2-(3-Fluorophenyl)cyclopropanecarboxylic acid is used as a reactant in the preparation of N-acyl-4-(heterocyclylaminomethyl)piperidines as NMDA/NR2B antagonists. |
| | 2-(3-Fluoro-phenyl)-cyclopropanecarboxylic acid Preparation Products And Raw materials |
|