- bis(2,5-dioxopyrrolidin-1-yl) 4,7,10,13,16,19,22,25,28-nonaoxahentriacontanedioate
-
- $0.00 / 1g
-
2026-02-05
- CAS:1008402-79-6
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
- Bis-PEG9-NHS ester
-
- $0.00 / 1g
-
2025-06-07
- CAS:1008402-79-6
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | Bis-PE21- NHS ester Basic information |
| Product Name: | Bis-PE21- NHS ester | | Synonyms: | Bis-PEG21-NHS Ester;α,ω-disuccinimidyl octaethylene glycol;α,ω-disuccinimidyl nonaethylene glycol;α,ω-disuccinimidyl dodecaethylene glycol;NHS-PEG16-NHS;BIS-PEG9-NHS;NHS-PEG24-NHS;Bis-PE21- NHS ester | | CAS: | 1008402-79-6 | | MF: | C30H48N2O17 | | MW: | 708.71 | | EINECS: | | | Product Categories: | | | Mol File: | 1008402-79-6.mol |  |
| | Bis-PE21- NHS ester Chemical Properties |
| Boiling point | 737.0±70.0 °C(Predicted) | | density | 1.31±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in DMSO, DCM, DMF | | form | solid or viscous liquid | | color | Colorless to Light orange to Yellow | | Water Solubility | water: soluble | | InChIKey | OVDFFVRBNAHLOH-UHFFFAOYSA-N | | SMILES | O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(ON2C(CCC2=O)=O)=O |
| WGK Germany | WGK 3 | | HS Code | 2942000090 | | Storage Class | 11 - Combustible Solids |
| | Bis-PE21- NHS ester Usage And Synthesis |
| Description | Bis-PEG9-NHS ester is a PEG linker containing two NHS ester groups. The hydrophilic PEG spacer increases solubility in aqueous media. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. | | Uses | Bis(2,5-dioxopyrrolidin-1-yl) 4,7,10,13,16,19,22,25,28-Nonaoxahentriacontane-1,31-dioate is a protein crosslinking agent. | | reaction suitability | reagent type: cross-linking reagent
reactivity: amine reactive | | IC 50 | Cleavable Linker; PEGs; Alkyl/ether |
| | Bis-PE21- NHS ester Preparation Products And Raw materials |
|