|
|
| | ISOPROPYL METHACRYLATE Basic information |
| Product Name: | ISOPROPYL METHACRYLATE | | Synonyms: | METHACRYLIC ACID ISOPROPYL ESTER;1-methylethyl2-methyl-2-propenoate;2-methyl-2-propenoicaci1-methylethylester;Acrylic acid, 2-methyl-, isopropyl ester;Isopropyl 2-methyl-2-propenoate;Isopropyl 2-methylacrylate;METHACRYLIC ACID ISOPROPYL ESTER (STABILIZED WITH MEHQ) 98+%;2-Propenoic acid, 2-methyl-, 1-methylethyl ester | | CAS: | 4655-34-9 | | MF: | C7H12O2 | | MW: | 128.17 | | EINECS: | 225-094-2 | | Product Categories: | monomer | | Mol File: | 4655-34-9.mol |  |
| | ISOPROPYL METHACRYLATE Chemical Properties |
| Melting point | -62.68°C (estimate) | | Boiling point | 125-126°C | | density | 0,885 g/cm3 | | refractive index | 1.4182 (589.3 nm 20℃) | | Fp | 25 °C | | Water Solubility | Insoluble in water | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C7H12O2/c1-5(2)7(8)9-6(3)4/h6H,1H2,2-4H3 | | InChIKey | BOQSSGDQNWEFSX-UHFFFAOYSA-N | | SMILES | C(OC(C)C)(=O)C(C)=C | | EPA Substance Registry System | Isopropyl methacrylate (4655-34-9) |
| Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | 3272 | | RTECS | OZ5020000 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 2916199590 |
| | ISOPROPYL METHACRYLATE Usage And Synthesis |
| General Description | Clear colorless liquid. | | Air & Water Reactions | Highly flammable. Insoluble in water. | | Reactivity Profile | ISOPROPYL METHACRYLATE may be sensitive to heat and light during long term storage. ISOPROPYL METHACRYLATE can also polymerize. | | Health Hazard | Inhalation or contact with material may irritate or burn skin and eyes. Fire may produce irritating, corrosive and/or toxic gases. Vapors may cause dizziness or suffocation. Runoff from fire control or dilution water may cause pollution. | | Fire Hazard | ISOPROPYL METHACRYLATE is flammable. |
| | ISOPROPYL METHACRYLATE Preparation Products And Raw materials |
|