| Company Name: |
Acesys Pharmatech
|
| Tel: |
18860950986 |
| Email: |
tangmanman@zenjipharma.com |
| Products Intro: |
Product Name:4,7-dichloro-2-methylquinoline CAS:50593-69-6 Purity:97% Package:5g;100g;1Kg
|
|
| | 4,7-DICHLORO-2-METHYLQUINOLINE Basic information |
| | 4,7-DICHLORO-2-METHYLQUINOLINE Chemical Properties |
| Melting point | 103.5-104 °C | | Boiling point | 301.3±37.0 °C(Predicted) | | density | 1.351±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 2.81±0.50(Predicted) | | color | Pale purple to purple | | InChI | 1S/C10H7Cl2N/c1-6-4-9(12)8-3-2-7(11)5-10(8)13-6/h2-5H,1H3 | | InChIKey | QTYCALFKBCOYLW-UHFFFAOYSA-N | | SMILES | ClC1=CC(C)=NC2=C1C=CC(Cl)=C2 |
| Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | HS Code | 2933499090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 4 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 4,7-DICHLORO-2-METHYLQUINOLINE Usage And Synthesis |
| | 4,7-DICHLORO-2-METHYLQUINOLINE Preparation Products And Raw materials |
|