- Roxadustat Impurity 26
-
- $0.00 / 10mg
-
2026-03-12
- CAS:1421312-34-6
- Min. Order: 10mg
- Purity: 98%
- Supply Ability: 500mg
|
| | 4-Hydroxy-1-methyl-7-phenoxy-3-isoquinolinecarboxylic acid methyl ester Basic information |
| Product Name: | 4-Hydroxy-1-methyl-7-phenoxy-3-isoquinolinecarboxylic acid methyl ester | | Synonyms: | fg-4592 int 2;1 - methyl - 4 - hydroxy - 7 - phenoxy isoquinoline - 3 - methyl formate;Fg-4592/FG4592 int 2;ROXA-019;4-Hydroxy-1-methyl-7-phenoxy-3-isoquinolinecarboxylic acid methyl ester;methyl 4-hydroxy-1-methyl-7-pheno1-(2,6-difluorobenzyl)-1H-1,2,3-triazole-4-carboxylic acid xyisoquinoline-3-carboxylate;3-Isoquinolinecarboxylic acid, 4-hydroxy-1-methyl-7-phenoxy-, methyl ester;4-Hydroxy-1-methyl-7-phenoxy-methyl ester-3-isoquinolinecarboxylic Acid | | CAS: | 1421312-34-6 | | MF: | C18H15NO4 | | MW: | 309.32 | | EINECS: | | | Product Categories: | API | | Mol File: | 1421312-34-6.mol |  |
| | 4-Hydroxy-1-methyl-7-phenoxy-3-isoquinolinecarboxylic acid methyl ester Chemical Properties |
| Boiling point | 537.3±45.0 °C(Predicted) | | density | 1.289±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere, 2-8°C | | pka | 6.24±0.50(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C18H15NO4/c1-11-15-10-13(23-12-6-4-3-5-7-12)8-9-14(15)17(20)16(19-11)18(21)22-2/h3-10,20H,1-2H3 | | InChIKey | WJGPMRFWBJZJOQ-UHFFFAOYSA-N | | SMILES | C1(C)C2=C(C=CC(OC3=CC=CC=C3)=C2)C(O)=C(C(OC)=O)N=1 |
| | 4-Hydroxy-1-methyl-7-phenoxy-3-isoquinolinecarboxylic acid methyl ester Usage And Synthesis |
| Uses | 4-Hydroxy-1-methyl-7-phenoxy-methyl ester-3-isoquinolinecarboxylic Acid is used as a reagent in the preparation of Roxadustat (H948180), which is a drug used to treat anemia and chronic renal insufficiency. | | Preparation | Add 25 g of glacial acetic acid solution containing methyl 1-((dimethylamino)methyl)-4-hydroxy-7-phenoxyisoquinolyl-3-carboxylate into a 1 L four-necked flask which contain 13 g Zinc powder. Then in a stirring state, add 7.5g of 5% dilute hydrochloric acid and raise the temperature to 50-60 ℃. When the raw materials in the liquid phase have basically reacted, reduce the temperature. Filter reaction solution. Rotary evaporated the filtrate obtain 4-Hydroxy-1-methyl-7-phenoxy-3-isoquinolinecarboxylic acid methyl ester (purity: 96.9%, yield: 87.7%). |
| | 4-Hydroxy-1-methyl-7-phenoxy-3-isoquinolinecarboxylic acid methyl ester Preparation Products And Raw materials |
|