|
|
| | 6,6'-Dimethyl-2,2'-dipyridyl Basic information |
| | 6,6'-Dimethyl-2,2'-dipyridyl Chemical Properties |
| Melting point | 93-95 °C(lit.) | | Boiling point | 286 °C | | density | 1.060±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | almost transparency in Methanol | | form | powder to crystaline | | pka | 5.20±0.22(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C12H12N2/c1-9-5-3-7-11(13-9)12-8-4-6-10(2)14-12/h3-8H,1-2H3 | | InChIKey | OHJPGUSXUGHOGE-UHFFFAOYSA-N | | SMILES | C1(C2=NC(C)=CC=C2)=NC(C)=CC=C1 | | CAS DataBase Reference | 4411-80-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | DW1767000 | | HS Code | 29333990 |
| | 6,6'-Dimethyl-2,2'-dipyridyl Usage And Synthesis |
| Chemical Properties | White to light brown crystal or powder | | Uses | 6,6′-dimethyl-2,2′-bipyridyl (6,6′-Dimethyl-2,2′-bipyridine)may be used in the synthesis of novel oligobipyridine ligands. | | General Description | 6,6′-dimethyl-2,2′-bipyridyl (dmbp) also known as 6,6′-dimethyl-2,2′-bipyridine, is commonly used as a ligand to form complexes with ions such as Pd(II), Pt(II), Cu(II), Co(II) and Zn(II). The crystalline structure of dmbp has been investigated. Its synthesis from 6-bromopicoline has been reported. |
| | 6,6'-Dimethyl-2,2'-dipyridyl Preparation Products And Raw materials |
|