| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,3-Dihydro-1H-quinolin-4-one Basic information |
| Product Name: | 2,3-Dihydro-1H-quinolin-4-one | | Synonyms: | 2,3-DIHYDRO-1H-QUINOLIN-4-ONE;AKOS 93029;4(1H)-QUINOLINONE, 2,3-DIHYDRO-;2,3-DIHYDRO-1H-QUINOLINE-4-ONE;1,2,3,4-tetrahydro-4-quinolinone hydrochloride;1,2,3,4-Tetrahydroquinolin-4-one;2,3-Dihydro-1H-quinolin-4-one HCl;1,2,3,4-Tetrahydroquinoline-4-one | | CAS: | 4295-36-7 | | MF: | C9H9NO | | MW: | 147.17 | | EINECS: | 275-428-6 | | Product Categories: | pharmacetical | | Mol File: | 4295-36-7.mol |  |
| | 2,3-Dihydro-1H-quinolin-4-one Chemical Properties |
| Melting point | 44 °C | | Boiling point | 195 °C(Press: 20 Torr) | | density | 1.142±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in Methanol | | pka | 2.68±0.20(Predicted) | | form | powder to crystal | | color | White to Yellow to Orange | | InChI | InChI=1S/C9H9NO/c11-9-5-6-10-8-4-2-1-3-7(8)9/h1-4,10H,5-6H2 | | InChIKey | BUWPZNOVIHAWHW-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C(=O)CC1 | | CAS DataBase Reference | 4295-36-7(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | HS Code | 2933.49.7000 |
| | 2,3-Dihydro-1H-quinolin-4-one Usage And Synthesis |
| Uses | 2,3-Dihydro-1H-quinolin-4-one is a beta-adrenergic blocking agents. | | Synthesis Reference(s) | Journal of the American Chemical Society, 71, p. 1901, 1949 DOI: 10.1021/ja01174a001 |
| | 2,3-Dihydro-1H-quinolin-4-one Preparation Products And Raw materials |
|