|
|
| | (2R)-2-[(4-Ethyl-2,3-dioxopiperazinyl)carbonylamino]-2-(4-hydroxyphenyl)acetic acid Basic information |
| Product Name: | (2R)-2-[(4-Ethyl-2,3-dioxopiperazinyl)carbonylamino]-2-(4-hydroxyphenyl)acetic acid | | Synonyms: | (R)-(-)-ALPHA-[[(4-ETHYL-2,3-DIOXO-1-PIPERAZINYL)CARBONYL]AMINO]-4-HYDROXYBENZENEACETIC ACID;(R)-(-)-[[(4-ETHYL-2,3-DIOXO-1-PIPERAZINYL)CARBONYL]AMINO]-4-HYDROXYBENZENEACETIC ACID;D-(-)-A-(4-ETHYL-2,3-DIOXO PIPERZINYL) CARBOCAMIDE-4-HYDROXYPHENYL-ACETIC ACID;D-(-)-2-(2,3-DIOXO-4-ETHYL-1-PIPERAZIN-CARBOXAMIDE)-ALPHA-4-HYDROXY PHENYL ACETIC ACID;D-(-)-2-[(4-ETHYL-2,3-DIOXO-1-PIPERAZINEYL)-CARBONYLAMINO]-2-(4-HYDROXYPHENYL) ACETIC ACID;2R-2-((4-ETHYL-2,3-DIOXYPIPERAZYL)FORMAMIDE)-P-HYDROXY PHENYLACETIC ACID;(2R)-2-[(4-ETHYL-2,3-DIOXOPIPERAZINYL)CARBONYLAMINO]-2-(4-HYDROXYPHENYL)ACETIC ACID;N-((4-ETHYL-2,3-DIOXO-1-PIPERAZINYL)CARBONYL)-A-AMINO-P- HYDROXYPHENYLACETIC ACID | | CAS: | 62893-24-7 | | MF: | C15H17N3O6 | | MW: | 335.32 | | EINECS: | 625-629-3 | | Product Categories: | Chiral Building Blocks;Heterocyclic Building Blocks;Piperazines | | Mol File: | 62893-24-7.mol | ![(2R)-2-[(4-Ethyl-2,3-dioxopiperazinyl)carbonylamino]-2-(4-hydroxyphenyl)acetic acid Structure](CAS/GIF/62893-24-7.gif) |
| | (2R)-2-[(4-Ethyl-2,3-dioxopiperazinyl)carbonylamino]-2-(4-hydroxyphenyl)acetic acid Chemical Properties |
| Melting point | 205 °C (dec.) (lit.) | | alpha | -0.85 º(c=1,MeOH) | | Boiling point | 471.96°C (rough estimate) | | density | 1.2546 (rough estimate) | | refractive index | 1.5600 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Sparingly) | | pka | 3.40±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]20/D 85°, c = 1 in methanol | | InChI | InChI=1/C15H17N3O6/c1-2-17-7-8-18(13(21)12(17)20)15(24)16-11(14(22)23)9-3-5-10(19)6-4-9/h3-6,11,19H,2,7-8H2,1H3,(H,16,24)(H,22,23)/t11-/s3 | | InChIKey | IPARGUVYMOMVNU-LBPXTSNRNA-N | | SMILES | C(N1CCN(CC)C(=O)C1=O)(=O)N[C@H](C1C=CC(O)=CC=1)C(=O)O |&1:13,r| | | CAS DataBase Reference | 62893-24-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | HS Code | 2933.59.8000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (2R)-2-[(4-Ethyl-2,3-dioxopiperazinyl)carbonylamino]-2-(4-hydroxyphenyl)acetic acid Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | (αR)-α-[[(4-Ethyl-2,3-dioxo-1-piperazinyl)carbonyl]amino]-4-hydroxy-benzeneacetic Acid is an intermediate used to prepare Cephalosporin derivatives with activities against both Gram-positive and Gram-negative bacteria. |
| | (2R)-2-[(4-Ethyl-2,3-dioxopiperazinyl)carbonylamino]-2-(4-hydroxyphenyl)acetic acid Preparation Products And Raw materials |
|