tert-Butyl (trans-4-(aminomethyl)cyclohexyl)carbamate manufacturers
|
| | tert-Butyl (trans-4-(aminomethyl)cyclohexyl)carbamate Basic information |
| Product Name: | tert-Butyl (trans-4-(aminomethyl)cyclohexyl)carbamate | | Synonyms: | carbamic acid [4-(aminomethyl)-2-tert-butylcyclohexyl] ester;TERT-BUTYL TRANS-4-AMINOMETHYLCYCLOHEXYLCARBAMATE;TERT-BUTYL TRANS-L-4-AMINOMETHYL CYCLOHEXYL CARBAMATE;TERT-BUTYLTRANS-L-4-AMINOMETHYLCYCLOHEXYCARBAMATE;tert-Butyl(trans-4-aomethylcyclohexyl)carbamate;trans-4-(boc-amino)cyclohexylmethylamine;CarbaMic acid,N-[trans-4-(aMinoMethyl)cyclohexyl]-, 1,1-diMethylethyl ester;trans-4-(Boc-aMino)cyclohexaneMethylaMine, 97% | | CAS: | 177583-27-6 | | MF: | C12H24N2O2 | | MW: | 228.33 | | EINECS: | | | Product Categories: | | | Mol File: | 177583-27-6.mol |  |
| | tert-Butyl (trans-4-(aminomethyl)cyclohexyl)carbamate Chemical Properties |
| Boiling point | 342.4±11.0 °C(Predicted) | | density | 1.01±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 12.52±0.40(Predicted) | | Appearance | White to off-white Solid | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C12H24N2O2/c1-12(2,3)16-11(15)14-10-6-4-9(8-13)5-7-10/h9-10H,4-8,13H2,1-3H3,(H,14,15)/t9-,10- | | InChIKey | NVQFOBONHIXDOC-MGCOHNPYSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H]1CC[C@@H](CN)CC1 |
| | tert-Butyl (trans-4-(aminomethyl)cyclohexyl)carbamate Usage And Synthesis |
| Description | tert-Butyl (trans-4-(aminomethyl)cyclohexyl)carbamate is an organic compound characterized by its carbamate functional group, which is derived from the reaction of an amine with a carbonyl compound. This substance features a tert-butyl group, providing steric hindrance that can influence its reactivity and solubility. | | Uses | trans-4-(Boc-amino)cyclohexanemethylamine is used as a raw material intermediates for pharmaceutical and chemical. |
| | tert-Butyl (trans-4-(aminomethyl)cyclohexyl)carbamate Preparation Products And Raw materials |
|