- 2-BROMO-6-FLUOROPHENOL
-
- $10.00 / 1KG
-
2026-03-20
- CAS:2040-89-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- 2-BROMO-6-FLUOROPHENOL
-
- $100.00 / 1kg
-
2024-04-25
- CAS:2040-89-3
- Min. Order: 1kg
- Purity: 99.93%
- Supply Ability: 1000kg per week
|
| Product Name: | 2-Bromo-6-fluorophenol | | Synonyms: | 2-BROMO-6-FLUOROPHENOL;2-Bromo-6-fluorophenol 96%;2-fluoro-6-bromophenol;Phenol, 2-bromo-6-fluoro-;2-Bromo-6-fluorophenol ISO 9001:2015 REACH;TIANFU-CHEM 2040-89-3 2-Bromo-6-fluorophenol;Phenol,2-bromo-6-fluoro-,98%;2-Brmo-6-fluorophenol | | CAS: | 2040-89-3 | | MF: | C6H4BrFO | | MW: | 191 | | EINECS: | | | Product Categories: | Phenol&Thiophenol&Mercaptan | | Mol File: | 2040-89-3.mol |  |
| | 2-Bromo-6-fluorophenol Chemical Properties |
| Melting point | 50 °C | | Boiling point | 173.0±20.0 °C(Predicted) | | density | 1.764±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | form | fused solid | | pka | 7.17±0.10(Predicted) | | color | White/off white | | InChI | InChI=1S/C6H4BrFO/c7-4-2-1-3-5(8)6(4)9/h1-3,9H | | InChIKey | DNFDDDWPODPCHU-UHFFFAOYSA-N | | SMILES | C1(O)=C(F)C=CC=C1Br | | CAS DataBase Reference | 2040-89-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2908190090 |
| | 2-Bromo-6-fluorophenol Usage And Synthesis |
| Application | 2-Bromo-6-fluorophenol is an organic synthesis intermediate and a pharmaceutical intermediate that can be used in laboratory research and development processes as well as in biochemical production processes. | | Chemical Properties | Pale yellow liquid |
| | 2-Bromo-6-fluorophenol Preparation Products And Raw materials |
|