|
|
| | Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate Basic information |
| Product Name: | Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate | | Synonyms: | RARECHEM AL BI 0939;TIMTEC-BB SBB003220;DIETHYL 2,4-DIMETHYL-1H-PYRROLE-3,5-DICARBOXYLATE;DIETHYL 2,4-DIMETHYLPYRROLE-3,5-DICARBOXYLATE;DIETHYL 3,5-DIMETHYL-1H-PYRROLE-2,4-DICARBOXYLATE;DIETHYL 3,5-DIMETHYL 2,4-DICARBOXYLATE PYRROLE;3,5-DIMETHYL-1H-PYRROLE-2,4-DICARBOXYLIC ACID DIETHYL ESTER;1H-Pyrrole-2,4-dicarboxylicacid,3,5-dimethyl-,diethylester | | CAS: | 2436-79-5 | | MF: | C12H17NO4 | | MW: | 239.27 | | EINECS: | 219-431-2 | | Product Categories: | D-DIF;Bioactive Small Molecules;Building Blocks;Cell Biology;Chemical Synthesis;Heterocyclic Building Blocks;Building Blocks;Heterocyclic Building Blocks;Pyrroles;Imidazoles, Pyrroles, Pyrazoles, Pyrrolidines;Sunitinib Intermediate;Pharmaceutical Intermediates;Pharmaceutial intermediates | | Mol File: | 2436-79-5.mol |  |
| | Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate Chemical Properties |
| Melting point | 135-136 °C(lit.) | | Boiling point | 381.93°C (rough estimate) | | density | 1.1724 (rough estimate) | | refractive index | 1.5300 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 14.69±0.50(Predicted) | | form | powder to crystal | | color | Light yellow to Yellow to Orange | | InChI | InChI=1S/C12H17NO4/c1-5-16-11(14)9-7(3)10(13-8(9)4)12(15)17-6-2/h13H,5-6H2,1-4H3 | | InChIKey | XSBSXJAYEPDGSF-UHFFFAOYSA-N | | SMILES | N1C(C)=C(C(OCC)=O)C(C)=C1C(OCC)=O | | LogP | 3.850 (est) | | CAS DataBase Reference | 2436-79-5(CAS DataBase Reference) | | NIST Chemistry Reference | 1H-Pyrrole-2,4-dicarboxylic acid, 3,5-dimethyl-, diethyl ester(2436-79-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29339900 |
| | Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate Usage And Synthesis |
| Chemical Properties | light yellow to light pink | | Uses | Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate can be used in organic synthesis and experimental research. | | Synthesis | Using Knorr pyrrole synthesis, diethyl 2,4-dimethyl-pyrrole-3,5-dicarboxylate was synthesized via one-pot method with ethyl acetoacetate and sodium nitrite as starting materials in the presence of acetic acid and zinc powder. |
| | Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate Preparation Products And Raw materials |
|