|
|
| | 4-Ethyl-2,3-dioxo-1-piperazine carbonyl chloride Basic information |
| Product Name: | 4-Ethyl-2,3-dioxo-1-piperazine carbonyl chloride | | Synonyms: | 4-Ethyl-2,3-dioxopiperazine-1-carboxylic acid chloride;DEPC
4-Ethyl-2,3-dioxo-1-piperazinecarbonylchloride;4-Ethyl-2,3-dioxo-1-piperazinecarbonyl chloride,80%,tech.;4-Ethyl-2,3-dioxo-1-piperazinecarbonyl chloride, in paraffin oil,80%,tech.;1-Chlorocarbonyl-2,3-dioxo-4-ethylpiperazine, 1-Chlorocarbonyl-4-ethylpiperazine-2,3-dione;(4-ethyl-2,3-dioxopiperazin-1-yl)carbonylchloranuide;Dioxo piperazine carbonyl chloride;4- ethyl-2,3- two oxygen-1- piperazinebenzoyl chloride | | CAS: | 59703-00-3 | | MF: | C7H9ClN2O3 | | MW: | 204.61 | | EINECS: | 261-867-0 | | Product Categories: | API Intermediate;Piperaizine;Piperazine derivates;Cefoperazone | | Mol File: | 59703-00-3.mol |  |
| | 4-Ethyl-2,3-dioxo-1-piperazine carbonyl chloride Chemical Properties |
| Melting point | 100 °C | | Boiling point | 292.9±23.0 °C(Predicted) | | density | 1.408±0.06 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Soluble), DMSO (Slightly) | | form | powder | | pka | -1.81±0.20(Predicted) | | color | White | | Water Solubility | decomposes | | Stability: | Moisture Sensitive | | InChI | 1S/C7H9ClN2O3/c1-2-9-3-4-10(7(8)13)6(12)5(9)11/h2-4H2,1H3 | | InChIKey | SXVBQOZRZIUHKU-UHFFFAOYSA-N | | SMILES | CCN1CCN(C(Cl)=O)C(=O)C1=O | | LogP | -1.48 | | CAS DataBase Reference | 59703-00-3(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 45-36/37/39-26 | | WGK Germany | WGK 3 | | HS Code | 2933599590 | | Storage Class | 13 - Non Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | 4-Ethyl-2,3-dioxo-1-piperazine carbonyl chloride Usage And Synthesis |
| Chemical Properties | White to tan powder, partially agglomerated | | Uses | 4-Ethyl-2,3-dioxo-1-piperazinecarbonyl Chloride is used as a reagent in the synthesis of amino(thienyl)benzamide derivatives which are used as histone deacetylase inhibitors and have antitumor activity. 4-Ethyl-2,3-dioxo-1-piperazinecarbonyl Chloride is also a reagent in the synthesis of Cefbuperazone (C242540); a second-generation cephalosporin antibiotic. |
| | 4-Ethyl-2,3-dioxo-1-piperazine carbonyl chloride Preparation Products And Raw materials |
|