O-SUCCINYL-L-HOMOSERINE manufacturers
|
| | O-SUCCINYL-L-HOMOSERINE Basic information |
| | O-SUCCINYL-L-HOMOSERINE Chemical Properties |
| Melting point | 180-181 °C | | Boiling point | 492.8±45.0 °C(Predicted) | | density | 1.392±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | Solid | | pka | 2.13±0.10(Predicted) | | color | White to off-white | | InChI | 1S/C8H13NO6/c9-5(8(13)14)3-4-15-7(12)2-1-6(10)11/h5H,1-4,9H2,(H,10,11)(H,13,14)/t5-/m0/s1 | | InChIKey | GNISQJGXJIDKDJ-YFKPBYRVSA-N | | SMILES | N[C@@H](CCOC(=O)CCC(O)=O)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | O-SUCCINYL-L-HOMOSERINE Usage And Synthesis |
| Uses | O-Succinyl-L-homoserine is a homoserine derivative. O-Succinyl-L-homoserine is an intermediate in the biosynthesis of methionine in Escherichia coli and Salmonella typhimurium[1]. | | Definition | ChEBI: The O-succinyl derivative of L-homoserine. | | References | [1] Huang JF, et, al. Metabolic engineering of E. coli for the production of O-succinyl-l-homoserine with high yield. 3 Biotech. 2018 Jul;8(7):310. |
| | O-SUCCINYL-L-HOMOSERINE Preparation Products And Raw materials |
|