- 2-amino-5-nitrobenzoic acid
-
- $0.00 / 25kg/paper drum
-
2026-02-15
- CAS:616-79-5
- Min. Order: 25kg/paper drum
- Purity: 97%
- Supply Ability: 20 tons
|
| | 2-Amino-5-nitrobenzoic acid Basic information |
| | 2-Amino-5-nitrobenzoic acid Chemical Properties |
| Melting point | 270 °C (dec.) (lit.) | | Boiling point | 315.51°C (rough estimate) | | density | 1.5181 (rough estimate) | | refractive index | 1.5880 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Insoluble | | pka | 4.08±0.10(Predicted) | | form | Powder | | color | Bright yellow | | Water Solubility | Insoluble | | BRN | 646219 | | Major Application | peptide synthesis | | InChI | InChI=1S/C7H6N2O4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,8H2,(H,10,11) | | InChIKey | RUCHWTKMOWXHLU-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC([N+]([O-])=O)=CC=C1N | | CAS DataBase Reference | 616-79-5(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 2-amino-5-nitro- (616-79-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 2 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Amino-5-nitrobenzoic acid Usage And Synthesis |
| Chemical Properties | BRIGHT YELLOW POWDER | | Uses | Intermediate in the preparation of nitro substituted quinazolones. | | Uses | 2-Amino-5-nitrobenzoic acid, is used as an intermediate for dyes and pharmaceuticals. | | Definition | ChEBI: An aminobenzoic acid in which the the amino group is ortho- to the carboxylic acid group, and which is substituted para- to the amino group by a nitro group. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 2-Amino-5-nitrobenzoic acid Preparation Products And Raw materials |
|