| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | MFCD12028444 Basic information |
| Product Name: | MFCD12028444 | | Synonyms: | 3-(3-isobutyl-1,2,4-oxadiazol-5-yl)piperidine;3-Isobutyl-5-(piperidin-3-yl)-1,2,4-oxadiazole | | CAS: | 915921-88-9 | | MF: | C11H19N3O | | MW: | 209.29 | | EINECS: | | | Product Categories: | | | Mol File: | 915921-88-9.mol |  |
| | MFCD12028444 Chemical Properties |
| form | solid | | InChI | 1S/C11H19N3O/c1-8(2)6-10-13-11(15-14-10)9-4-3-5-12-7-9/h8-9,12H,3-7H2,1-2H3 | | InChIKey | APINFVMTWMDIIJ-UHFFFAOYSA-N | | SMILES | CC(C)CC1=NOC(C2CNCCC2)=N1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1 |
| | MFCD12028444 Usage And Synthesis |
| | MFCD12028444 Preparation Products And Raw materials |
|