|
|
| | 14H- benzo [c] benzo [4,5] thieno [2,3-a] carbazole[ Basic information | | Uses |
| | 14H- benzo [c] benzo [4,5] thieno [2,3-a] carbazole[ Chemical Properties |
| Boiling point | 624.1±28.0 °C(Predicted) | | density | 1.419±0.06 g/cm3(Predicted) | | pka | 16.55±0.30(Predicted) | | InChI | InChI=1S/C22H13NS/c1-2-8-14-13(7-1)19-15-9-3-5-11-17(15)23-21(19)22-20(14)16-10-4-6-12-18(16)24-22/h1-12,23H | | InChIKey | RSQSESGFUZXJNM-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C2=C1C1SC3=CC=CC=C3C=1C1=CC=CC=C12 |
| | 14H- benzo [c] benzo [4,5] thieno [2,3-a] carbazole[ Usage And Synthesis |
| Uses | 14H-benzo[C]benzo[4,5]thieno[2,3-A]carbazole is an organic intermediate that can be prepared in three steps from 5-bromobenzo[b]naphtha[1,2-d]thiophene. It has been reported in the literature to be used in the preparation of specific compounds for use as materials in organic electronic components. |
| | 14H- benzo [c] benzo [4,5] thieno [2,3-a] carbazole[ Preparation Products And Raw materials |
|