| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
H-Cit-PABA manufacturers
- H-Cit-PABA
-
- $1.00
-
2019-12-24
- CAS:1037794-22-1
- Min. Order: 1g
- Purity: 99.99%
- Supply Ability: 200kg
|
| | H-Cit-PABA Basic information |
| Product Name: | H-Cit-PABA | | Synonyms: | (S)-2-amino-N-(4-(hydroxymethyl)phenyl)-5-ureidopentanamide;H-Cit-PABA;Cit-PAB-OH;Pentanamide, 2-amino-5-[(aminocarbonyl)amino]-N-[4-(hydroxymethyl)phenyl]-, (2S)-;N5-Carbamoyl-N-[4-(hydroxymethyl)phenyl]-L-ornithinamide;(2S)-2-Amino-5-[(aminocarbonyl)amino]-N-[4-(hydroxymethyl)phenyl]pentanamide;CIT-PAB | | CAS: | 1037794-22-1 | | MF: | C13H20N4O3 | | MW: | 280.32 | | EINECS: | | | Product Categories: | Linker | | Mol File: | 1037794-22-1.mol |  |
| | H-Cit-PABA Chemical Properties |
| Boiling point | 582.7±50.0 °C(Predicted) | | density | 1.297±0.06 g/cm3(Predicted) | | pka | 13.86±0.70(Predicted) | | InChI | InChI=1S/C13H20N4O3/c14-11(2-1-7-16-13(15)20)12(19)17-10-5-3-9(8-18)4-6-10/h3-6,11,18H,1-2,7-8,14H2,(H,17,19)(H3,15,16,20)/t11-/m0/s1 | | InChIKey | KJJITHAVZJBOHG-NSHDSACASA-N | | SMILES | C(NC1=CC=C(CO)C=C1)(=O)[C@@H](N)CCCNC(N)=O |
| | H-Cit-PABA Usage And Synthesis |
| | H-Cit-PABA Preparation Products And Raw materials |
|