|
|
| | tert-butyl 7-oxo-5-oxa-2,8-diazaspiro[3.5]nonane-2-carboxylate Basic information |
| | tert-butyl 7-oxo-5-oxa-2,8-diazaspiro[3.5]nonane-2-carboxylate Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H18N2O4/c1-10(2,3)17-9(15)13-6-11(7-13)5-12-8(14)4-16-11/h4-7H2,1-3H3,(H,12,14) | | InChIKey | XVGAQOILVLJWLR-UHFFFAOYSA-N | | SMILES | C1C2(CNC(=O)CO2)CN1C(OC(C)(C)C)=O |
| | tert-butyl 7-oxo-5-oxa-2,8-diazaspiro[3.5]nonane-2-carboxylate Usage And Synthesis |
| Uses | Tert-butyl 7-oxo-5-oxa-2,8-diazaspiro[3.5]nonane-2-carboxylate is a reactant used in the efficient preparation of diverse array of amino alcohol chiral fragments. |
| | tert-butyl 7-oxo-5-oxa-2,8-diazaspiro[3.5]nonane-2-carboxylate Preparation Products And Raw materials |
|