DBCO-C6-acid manufacturers
- DBCO-?C6-?acid
-
- $0.00 / 100mg
-
2026-01-04
- CAS:1425485-72-8
- Min. Order:
- Purity:
- Supply Ability: 10g
- DBCO-C6-acid
-
- $0.00 / 100mg
-
2025-06-07
- CAS:1425485-72-8
- Min. Order: 100mg
- Purity: >99.00%
- Supply Ability: 1g
|
| | DBCO-C6-acid Basic information |
| Product Name: | DBCO-C6-acid | | Synonyms: | DBCO-C6-acid;DBCO-(CH2)4-COOH;CAS_1425485-72-8;DBCO acid 3;Dibenz[b,f]azocine-5(6H)-hexanoic acid, 11,12-didehydro-ε-oxo-;11,12-Didehydro-ε-oxodibenz[b,f]azocine-5(6H)-hexanoic acid;(Z)-6-(dibenzo[b,f]azocin-5(6H)-yl)hexanoic acid;6-(2-azatricyclo[10.4.0.0??]hexadeca-1(12),4(9),5,7,13,15-hexaen-10-yn-2-yl)-6-oxo-hexanoic acid | | CAS: | 1425485-72-8 | | MF: | C21H19NO3 | | MW: | 333.39 | | EINECS: | | | Product Categories: | | | Mol File: | 1425485-72-8.mol |  |
| | DBCO-C6-acid Chemical Properties |
| Boiling point | 634.4±55.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | Soluble in DMSO, DMF, DCM, THF, Chloroform | | form | Solid | | pka | 4.69±0.10(Predicted) | | color | Off-white to light brown | | Appearance | White or light grey solid | | InChI | InChI=1S/C21H19NO3/c23-20(11-5-6-12-21(24)25)22-15-18-9-2-1-7-16(18)13-14-17-8-3-4-10-19(17)22/h1-4,7-10H,5-6,11-12,15H2,(H,24,25) | | InChIKey | NIRLBCOFKPVQLM-UHFFFAOYSA-N | | SMILES | C(N1CC2=CC=CC=C2C#CC2=CC=CC=C12)(=O)CCCCC(=O)O |
| | DBCO-C6-acid Usage And Synthesis |
| Description | DBCO-C6-Acid is an analog of DBCO-Acid with an extended 6-carbon atom spacer arm. The extended 6-carbon atom spacer arm improves its derivatization efficiency and the stability of the yielded conjugates. This spacer arm also improves solubility in organic solvents such as dichloromethane, chloroform, THF, and ethyl acetate. DBCO is commonly used for copper-free Click Chemistry reactions. | | Uses | DBCO-C6 Acid is a reagent in the preparation of N,?N-?dialkylhydroxylamines. | | IC 50 | Non-cleavable Linker |
| | DBCO-C6-acid Preparation Products And Raw materials |
|