|
|
| | 5-Bromo-2-methyl-benzoic acid tert-butyl ester Basic information |
| Product Name: | 5-Bromo-2-methyl-benzoic acid tert-butyl ester | | Synonyms: | 5-Bromo-2-methyl-benzoic acid tert-butyl ester;YROBYZPUNZSEFZ-UHFFFAOYSA-N;TERT-BUTYL 5-BROMO-2-METHYLBENZOATE*;Benzoic acid, 5-bromo-2-methyl-, 1,1-dimethylethyl ester;5-Bromo-2-methyl-benzoic acid tert-butyl ester ISO 9001：2015 REACH;tert-butyl 5-bromo-2-methyl-benzoate - [B81638] | | CAS: | 1202551-75-4 | | MF: | C12H15BrO2 | | MW: | 271.15 | | EINECS: | | | Product Categories: | | | Mol File: | 1202551-75-4.mol |  |
| | 5-Bromo-2-methyl-benzoic acid tert-butyl ester Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C12H15BrO2/c1-8-5-6-9(13)7-10(8)11(14)15-12(2,3)4/h5-7H,1-4H3 | | InChIKey | YROBYZPUNZSEFZ-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)C1=CC(Br)=CC=C1C |
| | 5-Bromo-2-methyl-benzoic acid tert-butyl ester Usage And Synthesis |
| | 5-Bromo-2-methyl-benzoic acid tert-butyl ester Preparation Products And Raw materials |
|