|
|
| | tert-butyl 2-(trifluoromethyl)piperazine-1-carboxylate Basic information |
| Product Name: | tert-butyl 2-(trifluoromethyl)piperazine-1-carboxylate | | Synonyms: | tert-butyl 2-(trifluoromethyl)piperazine-1-carboxylate;1-Piperazinecarboxylic acid, 2-(trifluoromethyl)-, 1,1-dimethylethyl ester;1-Boc-2-(trifluoromethyl)piperazine;1-Piperazinecarboxylic acid, 2-(trifluoromethyl)-, 1,1-dimethylethyl ester (9CI, ACI);2-(trifluoromethyl)azine-1-carboxylic acidtertbutyl ester | | CAS: | 886779-77-7 | | MF: | C10H17F3N2O2 | | MW: | 254.25 | | EINECS: | | | Product Categories: | | | Mol File: | 886779-77-7.mol |  |
| | tert-butyl 2-(trifluoromethyl)piperazine-1-carboxylate Chemical Properties |
| Boiling point | 263.4±35.0 °C(Predicted) | | density | 1.189±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 6.95±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H17F3N2O2/c1-9(2,3)17-8(16)15-5-4-14-6-7(15)10(11,12)13/h7,14H,4-6H2,1-3H3 | | InChIKey | ODGMABGNQLJFIX-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCNCC1C(F)(F)F |
| | tert-butyl 2-(trifluoromethyl)piperazine-1-carboxylate Usage And Synthesis |
| | tert-butyl 2-(trifluoromethyl)piperazine-1-carboxylate Preparation Products And Raw materials |
|