4-Iodo-2,2-dimethyl-tetrahydro-pyran manufacturers
|
| | 4-Iodo-2,2-dimethyl-tetrahydro-pyran Basic information |
| Product Name: | 4-Iodo-2,2-dimethyl-tetrahydro-pyran | | Synonyms: | 4-IODO-2,2-DIMETHYLTETRAHYDRO-2H-PYRAN;2H-Pyran,tetrahydro-4-iodo-2,2-dimethyl-;4-iodo-2,2-dimethyloxane;4-Iodo-2,2-dimethyltetrahydrofuran;4-Iodo-2,2-dimethyltetrahydro-2H-pyran 98%;4-lodo-2,2-dimethyl-tetrahyd ro-pyran | | CAS: | 882687-80-1 | | MF: | C7H13IO | | MW: | 240.08 | | EINECS: | | | Product Categories: | | | Mol File: | 882687-80-1.mol |  |
| | 4-Iodo-2,2-dimethyl-tetrahydro-pyran Chemical Properties |
| Boiling point | 220.6±33.0 °C(Predicted) | | density | 1.56±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | InChI | InChI=1S/C7H13IO/c1-7(2)5-6(8)3-4-9-7/h6H,3-5H2,1-2H3 | | InChIKey | CTPMPYIKWARWDI-UHFFFAOYSA-N | | SMILES | C1(C)(C)OCCC(I)C1 |
| | 4-Iodo-2,2-dimethyl-tetrahydro-pyran Usage And Synthesis |
| | 4-Iodo-2,2-dimethyl-tetrahydro-pyran Preparation Products And Raw materials |
|