| Company Name: |
nanjing Gold |
| Tel: |
13376084917 13376082704 |
| Email: |
3930959291@qq.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-amino-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione Basic information |
| Product Name: | 5-amino-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione | | Synonyms: | 1H-Isoindole-1,3(2H)-dione, 5-amino-2-(2,6-dioxo-3-piperidinyl)-;Pomalidomide Impurity F;5-Amino-2-(2,6-dioxo-3-piperidinyl)-1H-isoindole-1,3(2H)-dione;5-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;Pomalidomide Impurity 25;Thalidomide 5-Aminoisoindoline Impurity;5-amino-2-(2,6-dioxo-3-piperidyl)isoindoline-1,3-dione;Pomalidomide Impurity 42 | | CAS: | 191732-76-0 | | MF: | C13H11N3O4 | | MW: | 273.24 | | EINECS: | | | Product Categories: | | | Mol File: | 191732-76-0.mol |  |
| | 5-amino-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione Chemical Properties |
| Melting point | >300 °C | | Boiling point | 603.8±50.0 °C(Predicted) | | density | 1.570±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Aqueous Base (Slightly), DMSO (Slightly, Sonicated) | | form | Solid | | pka | 10.83±0.40(Predicted) | | color | Green to Dark Green | | InChI | 1S/C13H11N3O4/c14-6-1-2-7-8(5-6)13(20)16(12(7)19)9-3-4-10(17)15-11(9)18/h1-2,5,9H,3-4,14H2,(H,15,17,18) | | InChIKey | IICWMVJMJVXCLY-UHFFFAOYSA-N | | SMILES | O=C1C2=CC=C(N)C=C2C(=O)N1C3C(=O)NC(=O)CC3 |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Repr. 1A |
| | 5-amino-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione Usage And Synthesis |
| Description | 5-Amino-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione is a thalidomide analog that can be useful in PROTAC research. | | Uses | 5-Aminothalidomide is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | | storage | Store at -20°C |
| | 5-amino-2-(2,6-dioxopiperidin-3-yl)isoindoline-1,3-dione Preparation Products And Raw materials |
|