| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 2,5-Bis[4-(azidomethyl)phenyl]-1,1-dimethyl-3,4-diphenyl-1H-silole Basic information |
| Product Name: | 2,5-Bis[4-(azidomethyl)phenyl]-1,1-dimethyl-3,4-diphenyl-1H-silole | | Synonyms: | 2,5-Bis[4-(azidomethyl)phenyl]-1,1-dimethyl-3,4-diphenyl-1H-silole;1,1-dimethyl-2,5-bis[4-(azidomethyl)phenyl]-3,4-diphenyl-1H-silole;2,5-Bis[4-(azidomethyl)phenyl]-1,1-dimethyl-3,4-diphenyl-1H-silole 96%;2,5-Bis[4-(azidomethyl)phenyl]-1,1-dimethyl-3,4-diphenyl-1H-silole | | CAS: | 1380491-43-9 | | MF: | C32H28N6Si | | MW: | 524.69042 | | EINECS: | | | Product Categories: | | | Mol File: | 1380491-43-9.mol | ![2,5-Bis[4-(azidomethyl)phenyl]-1,1-dimethyl-3,4-diphenyl-1H-silole Structure](CAS/20180703/GIF/1380491-43-9.gif) |
| | 2,5-Bis[4-(azidomethyl)phenyl]-1,1-dimethyl-3,4-diphenyl-1H-silole Chemical Properties |
| form | solid | | InChI | 1S/C32H28N6Si/c1-39(2)31(27-17-13-23(14-18-27)21-35-37-33)29(25-9-5-3-6-10-25)30(26-11-7-4-8-12-26)32(39)28-19-15-24(16-20-28)22-36-38-34/h3-20H,21-22H2,1-2H3 | | InChIKey | ZMHVJCSUTIHLNO-UHFFFAOYSA-N | | SMILES | C[Si]1(C)C(C2=CC=C(CN=[N+]=[N-])C=C2)=C(C3=CC=CC=C3)C(C4=CC=CC=C4)=C1C5=CC=C(CN=[N+]=[N-])C=C5 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,5-Bis[4-(azidomethyl)phenyl]-1,1-dimethyl-3,4-diphenyl-1H-silole Usage And Synthesis |
| Uses | Silole-N3 is a "Clickable" aggregation-induced emission (AIE) material for use in circularly polarised luminescence (CPL). | | General Description | Silole is an represents a species of efficient emitter. A variety of applications can be developed through functionalization of silole. Taking advantage of the azide-alkyne click reaction, silole can be easily tailored to construct different materials. |
| | 2,5-Bis[4-(azidomethyl)phenyl]-1,1-dimethyl-3,4-diphenyl-1H-silole Preparation Products And Raw materials |
|