| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 6,12-Bis(2,3,4,5,6-pentafluorophenyl)indeno[1,2-b]fluorene 95% Basic information |
| Product Name: | 6,12-Bis(2,3,4,5,6-pentafluorophenyl)indeno[1,2-b]fluorene 95% | | Synonyms: | 6,12-Bis(2,3,4,5,6-pentafluorophenyl)indeno[1,2-b]fluorene 95%;6,12-Bis(2,3,4,5,6-pentafluorophenyl)indeno[1,2-b]fluorene;Indeno[1,2-b]fluorene, 6,12-bis(2,3,4,5,6-pentafluorophenyl)-;6,12-Bis(2,3,4,5,6-pentafluorophenyl)indeno[1,2-b]fluorene | | CAS: | 1382350-89-1 | | MF: | C32H10F10 | | MW: | 584.41 | | EINECS: | | | Product Categories: | | | Mol File: | 1382350-89-1.mol | ![6,12-Bis(2,3,4,5,6-pentafluorophenyl)indeno[1,2-b]fluorene 95% Structure](CAS/20180703/GIF/1382350-89-1.gif) |
| | 6,12-Bis(2,3,4,5,6-pentafluorophenyl)indeno[1,2-b]fluorene 95% Chemical Properties |
| Melting point | 380-385°C | | Boiling point | 752.5±60.0 °C(Predicted) | | density | 1.63±0.1 g/cm3(Predicted) | | form | powder | | InChI | 1S/C32H10F10/c33-23-21(24(34)28(38)31(41)27(23)37)19-13-7-3-1-5-11(13)15-9-18-16(10-17(15)19)12-6-2-4-8-14(12)20(18)22-25(35)29(39)32(42)30(40)26(22)36/h1-10H | | InChIKey | OXAQTDQMTJVZOI-UHFFFAOYSA-N | | SMILES | FC1=C(F)C(F)=C(F)C(F)=C1C2=C3C=CC=CC3=C4C=C5C(C6=C(F)C(F)=C(F)C(F)=C6F)=C7C=CC=CC7=C5C=C42 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 6,12-Bis(2,3,4,5,6-pentafluorophenyl)indeno[1,2-b]fluorene 95% Usage And Synthesis |
| Uses | Ambipolar organic semiconductor for Organic Field Effect Transistor (OFET) applications.
The field-effect hole and electron mobilities extracted from its single crystal ambipolar transistor are 7 × 10^-4 and 3 × 10^-3 cm^2 V^-1 s^-1 in the saturation regime.
HOMO: -6.17 eV
LUMO: -4.00 eV | | General Description | 6,12-Bis(2,3,4,5,6-pentafluorophenyl)indeno[1,2-b]fluorene is a conjugated polycyclic hydrocarbon that has an indeno[1,2-b]fluorene as the base structure. It has potential application in the development of organic electronics. |
| | 6,12-Bis(2,3,4,5,6-pentafluorophenyl)indeno[1,2-b]fluorene 95% Preparation Products And Raw materials |
|