| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | SM(PEG)24 (PEGylated, long-chain SMCC crosslinker) Basic information |
| | SM(PEG)24 (PEGylated, long-chain SMCC crosslinker) Chemical Properties |
| storage temp. | -20°C | | form | powder | | InChIKey | GRDUWUCYIIEBIS-UHFFFAOYSA-N | | SMILES | O=C(N1OC(CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(CCN2C(C=CC2=O)=O)=O)=O)CCC1=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | SM(PEG)24 (PEGylated, long-chain SMCC crosslinker) Usage And Synthesis |
| Uses | SM(PEG)24 can be used as a crosslinker in:
- The study of chemical cross-linking of glyceraldehyde-3-phosphate dehydrogenase (GAPDH) and RNAses using the high-mass MALDI-MS technique.
- Preparation of protein G-liposomal nanovesicles applicable as sensors in the detection of gentamycin in the milk sample.
- Conjugation of catalase to streptavidin, which is helpful in the detection of analytes at very low concentrations using ELISA technique.
| | General Description | SM(PEG)n NHS- and maleimide-activated PEG compounds for crosslinking between primary amines (NH2) and sulfhydryl (SH) groups in proteins and other molecules. A complete set of compounds are offered, each having the same heterobifunctional structure (NHS-PEGn-Maleimide) but differing in the number of discrete ethylene glycol units ( n = 2, 4, 6, 8, 12 or 24). The N-hydroxysuccinimide ester (NHS) group reacts specifically and efficiently with lysine and N-terminal amino groups at pH 7-9 to form stable amide bonds. The maleimide group reacts with reduced sulfhydryls at pH 6.5-7.5 to form stable thioether bonds | | reaction suitability | reagent type: cross-linking reagent |
| | SM(PEG)24 (PEGylated, long-chain SMCC crosslinker) Preparation Products And Raw materials |
|