|
|
| | 3-CYANO-7-(DIETHYLAMINO)COUMARIN Basic information |
| Product Name: | 3-CYANO-7-(DIETHYLAMINO)COUMARIN | | Synonyms: | 3-CYANO-7-(DIETHYLAMINO)COUMARIN;RARECHEM AB KA K022;7-(Diethylamino)coumarin-3-carbonitrile;S2145;7-Diethylamino-2-oxo-2H-chromene-3-carbonitrile;7-(Diethylamino)coumarin-3-carbonitrile>;2H-1-Benzopyran-3-carbonitrile, 7-(diethylamino)-2-oxo-;7-(Diethylamino)-2-oxochromene-3-carbonitrile | | CAS: | 51473-74-6 | | MF: | C14H14N2O2 | | MW: | 242.27 | | EINECS: | | | Product Categories: | | | Mol File: | 51473-74-6.mol |  |
| | 3-CYANO-7-(DIETHYLAMINO)COUMARIN Chemical Properties |
| Melting point | 228.0 to 232.0 °C | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | Light yellow to Yellow to Orange | | λmax | 428nm(EtOH)(lit.) | | InChI | InChI=1S/C14H14N2O2/c1-3-16(4-2)12-6-5-10-7-11(9-15)14(17)18-13(10)8-12/h5-8H,3-4H2,1-2H3 | | InChIKey | LOUYEVRVQGFIFB-UHFFFAOYSA-N | | SMILES | C1(=O)OC2=CC(N(CC)CC)=CC=C2C=C1C#N |
| | 3-CYANO-7-(DIETHYLAMINO)COUMARIN Usage And Synthesis |
| Description | 7-Diethylamino-2-oxo-2H-chromene-3-carbonitrile is a fluorescent probe. | | Definition | ChEBI: 7-(diethylamino)-2-oxo-1-benzopyran-3-carbonitrile is a member of coumarins. |
| | 3-CYANO-7-(DIETHYLAMINO)COUMARIN Preparation Products And Raw materials |
|