|
|
| | 3,3-DIMETHYL-1-INDANONE Basic information |
| Product Name: | 3,3-DIMETHYL-1-INDANONE | | Synonyms: | AKOS BC-0396;3,3-DIMETHYL-1-INDANONE;3,3-dimethylindan-1-one;1H-Inden-1-one,2,3-dihydro-3,3-di-;1,1-Dimethyl-1H-indene-3(2H)-one;3,3-Dimethyl-2,3-dihydro-1H-indene-1-one;3,3-Dimethyl-2,3-dihydro-1H-inden-1-one;1H-Inden-1-one, 2,3-dihydro-3,3-diMethyl- | | CAS: | 26465-81-6 | | MF: | C11H12O | | MW: | 160.21 | | EINECS: | 251-203-8 | | Product Categories: | | | Mol File: | 26465-81-6.mol |  |
| | 3,3-DIMETHYL-1-INDANONE Chemical Properties |
| Boiling point | 122 °C / 16mmHg | | density | 1.03 | | refractive index | 1.5410-1.5450 | | storage temp. | Inert atmosphere,2-8°C | | form | clear liquid | | color | Light yellow to Brown | | InChI | InChI=1S/C11H12O/c1-11(2)7-10(12)8-5-3-4-6-9(8)11/h3-6H,7H2,1-2H3 | | InChIKey | QWZAOSKLFKAEOK-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)C(C)(C)C1 | | LogP | 3.130 (est) |
| Risk Statements | 52 | | HS Code | 2914390090 |
| | 3,3-DIMETHYL-1-INDANONE Usage And Synthesis |
| Chemical Properties | Colorless Liquid | | Uses | 3,3-Dimethyl 1-indanone is used as a reagent to synthesize Indole (I577320) and Indoline (I627200) chromophores, compounds that have potential antioxidant properties. 3,3-Dimethyl 1-indanone is also a component of cigarette tobacco. | | Synthesis Reference(s) | Journal of the American Chemical Society, 108, p. 6424, 1986 DOI: 10.1021/ja00280a070 |
| | 3,3-DIMETHYL-1-INDANONE Preparation Products And Raw materials |
|