|
|
| | Methyl 2,4-dichloropyrimidine-6-carboxylate Basic information |
| Product Name: | Methyl 2,4-dichloropyrimidine-6-carboxylate | | Synonyms: | 2,6-DICHLORO-PYRIMIDINE-4-CARBOXYLIC ACID ETHYL ESTER;2,6-Dichloro-pyrimidine-4-carboxylic acid methyl ester;NSC45044;Methyl 2,4-dichloropyrimidine-6-carboxylate 99%;Methyl2,4-dichloropyrimidine-6-carboxylate99%;2-(3-CHLOROPHENYL)MALONDIALDEHYDE;4-Methyl-2-(3,4-dichlorophenyl)thiazole-5-carboxylicacid;Methyl 2,4-dichloropyrimidine-6-carboxylate | | CAS: | 6299-85-0 | | MF: | C6H4Cl2N2O2 | | MW: | 207.01 | | EINECS: | 674-238-4 | | Product Categories: | Heterocycle-Pyrimidine series;pharmacetical | | Mol File: | 6299-85-0.mol |  |
| | Methyl 2,4-dichloropyrimidine-6-carboxylate Chemical Properties |
| Melting point | 54-56 | | Boiling point | 306 ºC | | density | 1.503 | | Fp | 139 ºC | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -5.83±0.30(Predicted) | | form | White to off white to faint cream flakes | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C6H4Cl2N2O2/c1-12-5(11)3-2-4(7)10-6(8)9-3/h2H,1H3 | | InChIKey | DQNQNLWKAGZNIT-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(Cl)=CC(C(OC)=O)=N1 |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2933599590 |
| | Methyl 2,4-dichloropyrimidine-6-carboxylate Usage And Synthesis |
| Synthesis | To a stirred suspension of orotic acid (20.00 g, 128.140 mmol) in POCI3(75 ml) was added DMF (catalytic amount, -0.5 ml) at ambient temperature, and the resulting reaction mixture was refluxed for 3 h. Excess of POC was removed by vacuum distillation after 3h of reflux. The obtained slurry was poured slowly into a 5 per cent mixture of methanol in chloroform (200 ml) at 0°C and stirred for 30 min. The organic layer obtained was washed with a saturated solution of NaHCC>3 (3 x 200 ml). The combined organic phase was dried over Na2S04, filtered and concentrated under reduced pressure, yielding Methyl 2,4-dichloropyrimidine-6-carboxylate (19.00 g, 91 .800 mmol). | | References | [1] Patent: WO2018/167276, 2018, A1. Location in patent: Paragraph 00131; 00132; 00133 |
| | Methyl 2,4-dichloropyrimidine-6-carboxylate Preparation Products And Raw materials |
|