|
|
| | 4'-BROMO-4-CHLOROBUTYROPHENONE Basic information |
| Product Name: | 4'-BROMO-4-CHLOROBUTYROPHENONE | | Synonyms: | P-BROMO-G-CHLOROBUTYROPHENONE;4'-Bromo-γ-chlorobutyrophenone;γ-Chloro-4'-bromobutyrophenone;4'-BROMO-4-CHLOROBUTYROPHENONE 98%;4'-Bromo-4-chlorobutyrophenone,99%;1-(4-BROMOPHENYL)-4-CHLORO-1-BUTANONE;1-(4-BROMOPHENYL)-4-CHLORO-1-OXOBUTANE;4-BROMO-GAMMA-CHLOROBUTYROPHENONE | | CAS: | 4559-96-0 | | MF: | C10H10BrClO | | MW: | 261.54 | | EINECS: | 224-930-3 | | Product Categories: | | | Mol File: | 4559-96-0.mol |  |
| | 4'-BROMO-4-CHLOROBUTYROPHENONE Chemical Properties |
| Melting point | 35.5-38 °C(lit.) | | Boiling point | 150-157 °C(Press: 6.5 Torr) | | density | 1.4780 (rough estimate) | | refractive index | 1.5963 (estimate) | | Fp | >230 °F | | storage temp. | Storage temp. 2-8°C | | Appearance | Colorless to light yellow <35°C Solid,>38°C Liquid | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/C10H10BrClO/c11-9-5-3-8(4-6-9)10(13)2-1-7-12/h3-6H,1-2,7H2 | | InChIKey | WJKPUMBLABGUCQ-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(Br)C=C1)(=O)CCCCl |
| | 4'-BROMO-4-CHLOROBUTYROPHENONE Usage And Synthesis |
| Chemical Properties | cream low melting powder | | Uses | 4'-Bromo-4-chlorobutyrophenone is used as a pharmaceutical & syntheses material intermediates. |
| | 4'-BROMO-4-CHLOROBUTYROPHENONE Preparation Products And Raw materials |
|