|
|
| | 4-(1-Acetylpiperazin-4-yl)phenol Basic information |
| | 4-(1-Acetylpiperazin-4-yl)phenol Chemical Properties |
| Melting point | 180-185 °C (lit.) | | Boiling point | 361.21°C (rough estimate) | | density | 1.1115 (rough estimate) | | vapor pressure | 0Pa at 20℃ | | refractive index | 1.6000 (estimate) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Powder | | pka | 12.18±0.30(Predicted) | | color | White to slightly pink or beige | | Water Solubility | 4.3 g/L (20 ºC) | | BRN | 795777 | | InChI | 1S/C12H16N2O2/c1-10(15)13-6-8-14(9-7-13)11-2-4-12(16)5-3-11/h2-5,16H,6-9H2,1H3 | | InChIKey | AGVNLFCRZULMKK-UHFFFAOYSA-N | | SMILES | CC(=O)N1CCN(CC1)c2ccc(O)cc2 | | LogP | 0.3 | | CAS DataBase Reference | 67914-60-7(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36-36/37/39-22 | | WGK Germany | 3 | | HS Code | 29214910 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-(1-Acetylpiperazin-4-yl)phenol Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | 1-Acetyl-4-(4-hydroxyphenyl)piperazine may be used in the preparation of 1-acetyl-4-(4-octadecyloxyphenyl)piperazine. It may also be used in the multi-step synthesis of ketoconazole, its 1,2,4-triazole and thiazole analogs. | | General Description | 1-Acetyl-4-(4-hydroxyphenyl)piperazine (AHPP), a piperazine derivative, is a structural analog of acetaminophen. Its multi-step preparation using bis-(2-chloroethyl)amine hydrochloride and p-aminophenol as starting materials has been reported.2 | | Flammability and Explosibility | Not classified |
| | 4-(1-Acetylpiperazin-4-yl)phenol Preparation Products And Raw materials |
|