|
|
| | 2,4,6-Trifluorobenzonitrile Basic information |
| Product Name: | 2,4,6-Trifluorobenzonitrile | | Synonyms: | 2,4,6-Ditrfluorobenzonitrile;2,4,6-TRIFLUOROBENZONITRILE,99%;2,4,6-TRIFLUOROBENZONITRILE;2,4,6-Trifluorobenzonitrile 98%;2,4,6-Trifluorobenzonitrile98%;Benzonitrile, 2,4,6-trifluoro-;High purity CAS 96606-37-0 2,4,6-Trifluorobenzonitrile in stock;Lasmiditan Impurity 48 | | CAS: | 96606-37-0 | | MF: | C7H2F3N | | MW: | 157.09 | | EINECS: | 642-872-0 | | Product Categories: | Aromatic Nitriles;Fluorobenzene;Nitrile;Aromatics Compounds;Aromatics;C6 to C7;Cyanides/Nitriles;Nitrogen Compounds;Fluorobenzene Series | | Mol File: | 96606-37-0.mol |  |
| | 2,4,6-Trifluorobenzonitrile Chemical Properties |
| Melting point | 57-61 °C | | Boiling point | 92 °C | | density | 1.2465 (estimate) | | Fp | 92°C | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | form | Solid | | color | White | | BRN | 5512504 | | InChI | InChI=1S/C7H2F3N/c8-4-1-6(9)5(3-11)7(10)2-4/h1-2H | | InChIKey | HTKFGTCCOJIUIK-UHFFFAOYSA-N | | SMILES | C(#N)C1=C(F)C=C(F)C=C1F | | CAS DataBase Reference | 96606-37-0(CAS DataBase Reference) |
| | 2,4,6-Trifluorobenzonitrile Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 2,4,6-Trifluorobenzonitrile (cas# 96606-37-0) is a compound useful in organic synthesis. |
| | 2,4,6-Trifluorobenzonitrile Preparation Products And Raw materials |
|